C8H12FNS — CID 159209209
2-(1-fluoroethyl)-5-propan-2-yl-1,3-thiazole (PubChem CID 159209209) has the molecular formula C8H12FNS and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-(1-fluoroethyl)-5-propan-2-yl-1,3-thiazole.
| Compound Name | 2-(1-fluoroethyl)-5-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 159209209 |
| Molecular Formula | C8H12FNS |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-(1-fluoroethyl)-5-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1cnc(C(C)F)s1 |
| InChI | InChI=1S/C8H12FNS/c1-5(2)7-4-10-8(11-7)6(3)9/h4-6H,1-3H3 |
| InChIKey | VLNCKAJEHUWRIH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |