C7H8N2S — CID 177099753
2-isocyano-5-propan-2-yl-1,3-thiazole (PubChem CID 177099753) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 2-isocyano-5-propan-2-yl-1,3-thiazole.
| Compound Name | 2-isocyano-5-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 177099753 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 2-isocyano-5-propan-2-yl-1,3-thiazole |
| SMILES | [C-]#[N+]c1ncc(C(C)C)s1 |
| InChI | InChI=1S/C7H8N2S/c1-5(2)6-4-9-7(8-3)10-6/h4-5H,1-2H3 |
| InChIKey | IVIQDMUYPXZCAQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|