C10H9FN2OS — CID 112694574
(2-amino-1,3-thiazol-5-yl)-(4-fluorophenyl)methanol (PubChem CID 112694574) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-5-yl)-(4-fluorophenyl)methanol.
| Compound Name | (2-amino-1,3-thiazol-5-yl)-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 112694574 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (2-amino-1,3-thiazol-5-yl)-(4-fluorophenyl)methanol |
| SMILES | Nc1ncc(C(O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C10H9FN2OS/c11-7-3-1-6(2-4-7)9(14)8-5-13-10(12)15-8/h1-5,9,14H,(H2,12,13) |
| InChIKey | GYZNAMLOFYADTQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |