C10H7F3N2OS — CID 114058083
(2-amino-1,3-thiazol-5-yl)-(2,4,5-trifluorophenyl)methanol (PubChem CID 114058083) has the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-5-yl)-(2,4,5-trifluorophenyl)methanol.
| Compound Name | (2-amino-1,3-thiazol-5-yl)-(2,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 114058083 |
| Molecular Formula | C10H7F3N2OS |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | (2-amino-1,3-thiazol-5-yl)-(2,4,5-trifluorophenyl)methanol |
| SMILES | Nc1ncc(C(O)c2cc(F)c(F)cc2F)s1 |
| InChI | InChI=1S/C10H7F3N2OS/c11-5-2-7(13)6(12)1-4(5)9(16)8-3-15-10(14)17-8/h1-3,9,16H,(H2,14,15) |
| InChIKey | RQUWJFDWFYELGB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|