C15H15ClF2OS — CID 82771349
(5-tert-butylthiophen-2-yl)-(4-chloro-2,5-difluorophenyl)methanol (PubChem CID 82771349) has the molecular formula C15H15ClF2OS and a molecular weight of 316.80 g/mol. Its IUPAC name is (5-tert-butylthiophen-2-yl)-(4-chloro-2,5-difluorophenyl)methanol.
| Compound Name | (5-tert-butylthiophen-2-yl)-(4-chloro-2,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 82771349 |
| Molecular Formula | C15H15ClF2OS |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (5-tert-butylthiophen-2-yl)-(4-chloro-2,5-difluorophenyl)methanol |
| SMILES | CC(C)(C)c1ccc(C(O)c2cc(F)c(Cl)cc2F)s1 |
| InChI | InChI=1S/C15H15ClF2OS/c1-15(2,3)13-5-4-12(20-13)14(19)8-6-11(18)9(16)7-10(8)17/h4-7,14,19H,1-3H3 |
| InChIKey | FNEDMJPYNPEICC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|