C12H8Cl2F2OS — CID 115786109
1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethanol (PubChem CID 115786109) has the molecular formula C12H8Cl2F2OS and a molecular weight of 309.16 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethanol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 115786109 |
| Molecular Formula | C12H8Cl2F2OS |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(5-chlorothiophen-2-yl)ethanol |
| SMILES | OC(Cc1ccc(Cl)s1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H8Cl2F2OS/c13-8-5-9(15)7(4-10(8)16)11(17)3-6-1-2-12(14)18-6/h1-2,4-5,11,17H,3H2 |
| InChIKey | GRMOOAVCMSQNPL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|