C14H9BrClF3O — CID 115786975
2-(2-bromo-4-fluorophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanol (PubChem CID 115786975) has the molecular formula C14H9BrClF3O and a molecular weight of 365.58 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanol.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 115786975 |
| Molecular Formula | C14H9BrClF3O |
| Molecular Weight | 365.58 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(F)cc1Br)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H9BrClF3O/c15-10-4-8(17)2-1-7(10)3-14(20)9-5-13(19)11(16)6-12(9)18/h1-2,4-6,14,20H,3H2 |
| InChIKey | JETGTZPYGTYJDM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|