C12H8BrClF2OS — CID 115790919
2-(3-bromothiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanol (PubChem CID 115790919) has the molecular formula C12H8BrClF2OS and a molecular weight of 353.62 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanol.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 115790919 |
| Molecular Formula | C12H8BrClF2OS |
| Molecular Weight | 353.62 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanol |
| SMILES | OC(Cc1sccc1Br)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H8BrClF2OS/c13-7-1-2-18-12(7)5-11(17)6-3-10(16)8(14)4-9(6)15/h1-4,11,17H,5H2 |
| InChIKey | HLGRMPCCJUCEMH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|