C12H9Cl3OS — CID 65150596
2-(5-chlorothiophen-2-yl)-1-(2,6-dichlorophenyl)ethanol (PubChem CID 65150596) has the molecular formula C12H9Cl3OS and a molecular weight of 307.63 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-(2,6-dichlorophenyl)ethanol.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-(2,6-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 65150596 |
| Molecular Formula | C12H9Cl3OS |
| Molecular Weight | 307.63 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-(2,6-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)s1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H9Cl3OS/c13-8-2-1-3-9(14)12(8)10(16)6-7-4-5-11(15)17-7/h1-5,10,16H,6H2 |
| InChIKey | USXGWTKBSZLUBF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |