C15H14Cl2O — CID 63016225
1-(2,6-dichlorophenyl)-2-(2-methylphenyl)ethanol (PubChem CID 63016225) has the molecular formula C15H14Cl2O and a molecular weight of 281.18 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-(2-methylphenyl)ethanol.
| Compound Name | 1-(2,6-dichlorophenyl)-2-(2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 63016225 |
| Molecular Formula | C15H14Cl2O |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-(2-methylphenyl)ethanol |
| SMILES | Cc1ccccc1CC(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H14Cl2O/c1-10-5-2-3-6-11(10)9-14(18)15-12(16)7-4-8-13(15)17/h2-8,14,18H,9H2,1H3 |
| InChIKey | BRAJZLPQOXBTDM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |