C15H17ClO2 — CID 65152747
2-(2-chlorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol (PubChem CID 65152747) has the molecular formula C15H17ClO2 and a molecular weight of 264.75 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol.
| Compound Name | 2-(2-chlorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol |
|---|---|
| PubChem CID | 65152747 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(2,4,5-trimethylfuran-3-yl)ethanol |
| SMILES | Cc1oc(C)c(C(O)Cc2ccccc2Cl)c1C |
| InChI | InChI=1S/C15H17ClO2/c1-9-10(2)18-11(3)15(9)14(17)8-12-6-4-5-7-13(12)16/h4-7,14,17H,8H2,1-3H3 |
| InChIKey | DWBFICCKRPIWFB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |