C14H17NO2 — CID 66461098
2-pyridin-4-yl-1-(2,4,5-trimethylfuran-3-yl)ethanol (PubChem CID 66461098) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-pyridin-4-yl-1-(2,4,5-trimethylfuran-3-yl)ethanol.
| Compound Name | 2-pyridin-4-yl-1-(2,4,5-trimethylfuran-3-yl)ethanol |
|---|---|
| PubChem CID | 66461098 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-pyridin-4-yl-1-(2,4,5-trimethylfuran-3-yl)ethanol |
| SMILES | Cc1oc(C)c(C(O)Cc2ccncc2)c1C |
| InChI | InChI=1S/C14H17NO2/c1-9-10(2)17-11(3)14(9)13(16)8-12-4-6-15-7-5-12/h4-7,13,16H,8H2,1-3H3 |
| InChIKey | STAKSLAWCZFVCF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |