C14H13N3OS — CID 105379207
(2-amino-1,3-thiazol-5-yl)-(2-methylquinolin-6-yl)methanol (PubChem CID 105379207) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-5-yl)-(2-methylquinolin-6-yl)methanol.
| Compound Name | (2-amino-1,3-thiazol-5-yl)-(2-methylquinolin-6-yl)methanol |
|---|---|
| PubChem CID | 105379207 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (2-amino-1,3-thiazol-5-yl)-(2-methylquinolin-6-yl)methanol |
| SMILES | Cc1ccc2cc(C(O)c3cnc(N)s3)ccc2n1 |
| InChI | InChI=1S/C14H13N3OS/c1-8-2-3-9-6-10(4-5-11(9)17-8)13(18)12-7-16-14(15)19-12/h2-7,13,18H,1H3,(H2,15,16) |
| InChIKey | JDDYRDZUEDAJSY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |