C14H16FN3S — CID 88927634
5-[(2-fluorophenyl)-pyrrolidin-1-ylmethyl]-1,3-thiazol-2-amine (PubChem CID 88927634) has the molecular formula C14H16FN3S and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)-pyrrolidin-1-ylmethyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-fluorophenyl)-pyrrolidin-1-ylmethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 88927634 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-[(2-fluorophenyl)-pyrrolidin-1-ylmethyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(C(c2ccccc2F)N2CCCC2)s1 |
| InChI | InChI=1S/C14H16FN3S/c15-11-6-2-1-5-10(11)13(18-7-3-4-8-18)12-9-17-14(16)19-12/h1-2,5-6,9,13H,3-4,7-8H2,(H2,16,17) |
| InChIKey | WTWAWZAXFFAYCP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |