C21H23FN4 — CID 166326924
1-[(2-fluorophenyl)-phenylmethyl]-4-(1-methylpyrazol-4-yl)piperazine (PubChem CID 166326924) has the molecular formula C21H23FN4 and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)-phenylmethyl]-4-(1-methylpyrazol-4-yl)piperazine.
| Compound Name | 1-[(2-fluorophenyl)-phenylmethyl]-4-(1-methylpyrazol-4-yl)piperazine |
|---|---|
| PubChem CID | 166326924 |
| Molecular Formula | C21H23FN4 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-[(2-fluorophenyl)-phenylmethyl]-4-(1-methylpyrazol-4-yl)piperazine |
| SMILES | Cn1cc(N2CCN(C(c3ccccc3)c3ccccc3F)CC2)cn1 |
| InChI | InChI=1S/C21H23FN4/c1-24-16-18(15-23-24)25-11-13-26(14-12-25)21(17-7-3-2-4-8-17)19-9-5-6-10-20(19)22/h2-10,15-16,21H,11-14H2,1H3 |
| InChIKey | MBUUZESAJSRGFC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |