About N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide
N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide (PubChem CID 88932342) has the molecular formula C11H12ClN3OS2
and a molecular weight of 301.82 g/mol. Its IUPAC name is N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide.
Molecular Properties
| Compound Name | N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide |
| PubChem CID | 88932342 |
| Molecular Formula | C11H12ClN3OS2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide |
| SMILES | CS(=O)N[C@@H](c1cnc(N)s1)c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClN3OS2/c1-18(16)15-10(9-6-14-11(13)17-9)7-4-2-3-5-8(7)12/h2-6,10,15H,1H3,(H2,13,14)/t10-,18?/m1/s1 |
| InChIKey | NDMGJHWAJVBEEU-DMPGVRBJSA-N |
| XLogP | 2.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide?
The IUPAC name of N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide (CID 88932342) is N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide.
What is the SMILES notation for N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide?
The canonical SMILES for N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide is CS(=O)N[C@@H](c1cnc(N)s1)c1ccccc1Cl.
What is the InChIKey of N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide?
The InChIKey is NDMGJHWAJVBEEU-DMPGVRBJSA-N. The full InChI is InChI=1S/C11H12ClN3OS2/c1-18(16)15-10(9-6-14-11(13)17-9)7-4-2-3-5-8(7)12/h2-6,10,15H,1H3,(H2,13,14)/t10-,18?/m1/s1.
What are the key properties of N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide?
N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide has a molecular weight of 301.82 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(R)-(2-amino-1,3-thiazol-5-yl)-(2-chlorophenyl)methyl]methanesulfinamide is sourced from PubChem (CID 88932342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).