C20H36S — CID 151127806
2,5-di(octan-3-yl)thiophene (PubChem CID 151127806) has the molecular formula C20H36S and a molecular weight of 308.58 g/mol. Its IUPAC name is 2,5-di(octan-3-yl)thiophene.
| Compound Name | 2,5-di(octan-3-yl)thiophene |
|---|---|
| PubChem CID | 151127806 |
| Molecular Formula | C20H36S |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2,5-di(octan-3-yl)thiophene |
| SMILES | CCCCCC(CC)c1ccc(C(CC)CCCCC)s1 |
| InChI | InChI=1S/C20H36S/c1-5-9-11-13-17(7-3)19-15-16-20(21-19)18(8-4)14-12-10-6-2/h15-18H,5-14H2,1-4H3 |
| InChIKey | MTOOIPPQNFOMJZ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|