C13H18N2S — CID 171834289
7-heptan-3-ylthieno[2,3-b]pyrazine (PubChem CID 171834289) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 7-heptan-3-ylthieno[2,3-b]pyrazine.
| Compound Name | 7-heptan-3-ylthieno[2,3-b]pyrazine |
|---|---|
| PubChem CID | 171834289 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 7-heptan-3-ylthieno[2,3-b]pyrazine |
| SMILES | CCCCC(CC)c1csc2nccnc12 |
| InChI | InChI=1S/C13H18N2S/c1-3-5-6-10(4-2)11-9-16-13-12(11)14-7-8-15-13/h7-10H,3-6H2,1-2H3 |
| InChIKey | IETOCGBFAHSJKM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |