C11H19ClN2O — CID 43513193
2-(2-chloroethyl)-5-heptan-3-yl-1,3,4-oxadiazole (PubChem CID 43513193) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-heptan-3-yl-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-heptan-3-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43513193 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-(2-chloroethyl)-5-heptan-3-yl-1,3,4-oxadiazole |
| SMILES | CCCCC(CC)c1nnc(CCCl)o1 |
| InChI | InChI=1S/C11H19ClN2O/c1-3-5-6-9(4-2)11-14-13-10(15-11)7-8-12/h9H,3-8H2,1-2H3 |
| InChIKey | IHRSEYNYAMZYTA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|