C13H25N3O — CID 62163225
N-ethyl-1-(5-heptan-3-yl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 62163225) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is N-ethyl-1-(5-heptan-3-yl-1,3,4-oxadiazol-2-yl)ethanamine.
| Compound Name | N-ethyl-1-(5-heptan-3-yl-1,3,4-oxadiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 62163225 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N-ethyl-1-(5-heptan-3-yl-1,3,4-oxadiazol-2-yl)ethanamine |
| SMILES | CCCCC(CC)c1nnc(C(C)NCC)o1 |
| InChI | InChI=1S/C13H25N3O/c1-5-8-9-11(6-2)13-16-15-12(17-13)10(4)14-7-3/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | HQEYWNLOYIEAML-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |