C8H5BrCl2N2 — CID 144797258
4-(1-bromoethenyl)-2,6-dichloro-5-ethenylpyrimidine (PubChem CID 144797258) has the molecular formula C8H5BrCl2N2 and a molecular weight of 279.95 g/mol. Its IUPAC name is 4-(1-bromoethenyl)-2,6-dichloro-5-ethenylpyrimidine.
| Compound Name | 4-(1-bromoethenyl)-2,6-dichloro-5-ethenylpyrimidine |
|---|---|
| PubChem CID | 144797258 |
| Molecular Formula | C8H5BrCl2N2 |
| Molecular Weight | 279.95 g/mol |
| Exact Mass | 277.90 |
| IUPAC Name | 4-(1-bromoethenyl)-2,6-dichloro-5-ethenylpyrimidine |
| SMILES | C=Cc1c(Cl)nc(Cl)nc1C(=C)Br |
| InChI | InChI=1S/C8H5BrCl2N2/c1-3-5-6(4(2)9)12-8(11)13-7(5)10/h3H,1-2H2 |
| InChIKey | GUSLLOHAXBPTRZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.95 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |