C10H10ClN3O — CID 155786317
2-chloro-4-(1-ethoxyethenyl)-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 155786317) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-chloro-4-(1-ethoxyethenyl)-5H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 2-chloro-4-(1-ethoxyethenyl)-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155786317 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-chloro-4-(1-ethoxyethenyl)-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | C=C(OCC)c1nc(Cl)nc2cc[nH]c12 |
| InChI | InChI=1S/C10H10ClN3O/c1-3-15-6(2)8-9-7(4-5-12-9)13-10(11)14-8/h4-5,12H,2-3H2,1H3 |
| InChIKey | DYUBUIUDXRRDES-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|