C15H14F3NOS — CID 142066192
4-(1-ethoxyethenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 142066192) has the molecular formula C15H14F3NOS and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-(1-ethoxyethenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 4-(1-ethoxyethenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 142066192 |
| Molecular Formula | C15H14F3NOS |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-(1-ethoxyethenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | C=C(OCC)c1nc(-c2ccc(C(F)(F)F)cc2)sc1C |
| InChI | InChI=1S/C15H14F3NOS/c1-4-20-9(2)13-10(3)21-14(19-13)11-5-7-12(8-6-11)15(16,17)18/h5-8H,2,4H2,1,3H3 |
| InChIKey | ODZPNZXQYSHKFN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|