C8H8ClN3O — CID 154641367
2-chloro-3-ethyl-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 154641367) has the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. Its IUPAC name is 2-chloro-3-ethyl-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-chloro-3-ethyl-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 154641367 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-chloro-3-ethyl-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCn1c(Cl)nc2cc[nH]c2c1=O |
| InChI | InChI=1S/C8H8ClN3O/c1-2-12-7(13)6-5(3-4-10-6)11-8(12)9/h3-4,10H,2H2,1H3 |
| InChIKey | YPHDPPLWPHGZOU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |