C9H8ClN3O — CID 155776068
2-chloro-3-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 155776068) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 2-chloro-3-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-chloro-3-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155776068 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2-chloro-3-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(Cl)nc2[nH]ccc2c1=O |
| InChI | InChI=1S/C9H8ClN3O/c1-2-5-13-8(14)6-3-4-11-7(6)12-9(13)10/h2-4,11H,1,5H2 |
| InChIKey | IKNFARJFGSXGAR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|