C8H7ClN2 — CID 11030208
5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 11030208) has the molecular formula C8H7ClN2 and a molecular weight of 166.61 g/mol. Its IUPAC name is 5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 11030208 |
| Molecular Formula | C8H7ClN2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | Cc1cc(Cl)nc2cc[nH]c12 |
| InChI | InChI=1S/C8H7ClN2/c1-5-4-7(9)11-6-2-3-10-8(5)6/h2-4,10H,1H3 |
| InChIKey | FHZBSORNJHMVPY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|