C10H14N2 — CID 143910334
ethane;7-methyl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 143910334) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is ethane;7-methyl-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | ethane;7-methyl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 143910334 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | ethane;7-methyl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CC.Cc1ccnc2cc[nH]c12 |
| InChI | InChI=1S/C8H8N2.C2H6/c1-6-2-4-9-7-3-5-10-8(6)7;1-2/h2-5,10H,1H3;1-2H3 |
| InChIKey | JYMMNKCKIYQCCV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |