C34H23BrN4 — CID 144976413
2-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6H-cyclohepta[b]indole (PubChem CID 144976413) has the molecular formula C34H23BrN4 and a molecular weight of 567.49 g/mol. Its IUPAC name is 2-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6H-cyclohepta[b]indole.
| Compound Name | 2-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6H-cyclohepta[b]indole |
|---|---|
| PubChem CID | 144976413 |
| Molecular Formula | C34H23BrN4 |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 2-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6H-cyclohepta[b]indole |
| SMILES | Brc1ccc2c(c1)c1c(n2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)CC=CC=C1 |
| InChI | InChI=1S/C34H23BrN4/c35-26-18-21-31-29(22-26)28-14-8-3-9-15-30(28)39(31)27-19-16-25(17-20-27)34-37-32(23-10-4-1-5-11-23)36-33(38-34)24-12-6-2-7-13-24/h1-14,16-22H,15H2 |
| InChIKey | JFKPYOLWKSSGBB-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |