C20H15N — CID 139394582
6-phenyl-7H-cyclohepta[c]quinoline (PubChem CID 139394582) has the molecular formula C20H15N and a molecular weight of 269.35 g/mol. Its IUPAC name is 6-phenyl-7H-cyclohepta[c]quinoline.
| Compound Name | 6-phenyl-7H-cyclohepta[c]quinoline |
|---|---|
| PubChem CID | 139394582 |
| Molecular Formula | C20H15N |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 6-phenyl-7H-cyclohepta[c]quinoline |
| SMILES | C1=CCc2c(-c3ccccc3)nc3ccccc3c2C=C1 |
| InChI | InChI=1S/C20H15N/c1-3-9-15(10-4-1)20-18-13-6-2-5-11-16(18)17-12-7-8-14-19(17)21-20/h1-12,14H,13H2 |
| InChIKey | NOEQRSZUYHCGBK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |