C22H22N2 — CID 144597039
N,N,5-trimethyl-3-phenyl-10H-cyclohepta[b]indol-2-amine (PubChem CID 144597039) has the molecular formula C22H22N2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N,N,5-trimethyl-3-phenyl-10H-cyclohepta[b]indol-2-amine.
| Compound Name | N,N,5-trimethyl-3-phenyl-10H-cyclohepta[b]indol-2-amine |
|---|---|
| PubChem CID | 144597039 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N,N,5-trimethyl-3-phenyl-10H-cyclohepta[b]indol-2-amine |
| SMILES | CN(C)c1cc2c3c(n(C)c2cc1-c1ccccc1)C=CC=CC3 |
| InChI | InChI=1S/C22H22N2/c1-23(2)21-15-19-17-12-8-5-9-13-20(17)24(3)22(19)14-18(21)16-10-6-4-7-11-16/h4-11,13-15H,12H2,1-3H3 |
| InChIKey | PWXMNVZYBJFTDM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |