C13H18Ge — CID 102154983
1,3,4-trimethyl-1-phenyl-2,5-dihydrogermole (PubChem CID 102154983) has the molecular formula C13H18Ge and a molecular weight of 246.90 g/mol. Its IUPAC name is 1,3,4-trimethyl-1-phenyl-2,5-dihydrogermole.
| Compound Name | 1,3,4-trimethyl-1-phenyl-2,5-dihydrogermole |
|---|---|
| PubChem CID | 102154983 |
| Molecular Formula | C13H18Ge |
| Molecular Weight | 246.90 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1,3,4-trimethyl-1-phenyl-2,5-dihydrogermole |
| SMILES | CC1=C(C)C[Ge](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C13H18Ge/c1-11-9-14(3,10-12(11)2)13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3 |
| InChIKey | XJQGUNADWFUZLF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.90 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|