About 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride
5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride (PubChem CID 174554385) has the molecular formula C14H15ClN2O
and a molecular weight of 262.74 g/mol. Its IUPAC name is 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride.
Molecular Properties
| Compound Name | 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride |
| PubChem CID | 174554385 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride |
| SMILES | CC(=O)c1ccccc1.Cl.[N-]=[N+]=C1C=CC=CC1 |
| InChI | InChI=1S/C8H8O.C6H6N2.ClH/c1-7(9)8-5-3-2-4-6-8;7-8-6-4-2-1-3-5-6;/h2-6H,1H3;1-4H,5H2;1H |
| InChIKey | FHBGVAWQVZDGSE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride?
The IUPAC name of 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride (CID 174554385) is 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride.
What is the SMILES notation for 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride?
The canonical SMILES for 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride is CC(=O)c1ccccc1.Cl.[N-]=[N+]=C1C=CC=CC1.
What is the InChIKey of 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride?
The InChIKey is FHBGVAWQVZDGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H6N2.ClH/c1-7(9)8-5-3-2-4-6-8;7-8-6-4-2-1-3-5-6;/h2-6H,1H3;1-4H,5H2;1H.
What are the key properties of 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride?
5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride has a molecular weight of 262.74 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazocyclohexa-1,3-diene;1-phenylethanone;hydrochloride is sourced from PubChem (CID 174554385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).