C8H10N2O2 — CID 160882104
5-diazocyclohexa-1,3-diene;methyl formate (PubChem CID 160882104) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-diazocyclohexa-1,3-diene;methyl formate.
| Compound Name | 5-diazocyclohexa-1,3-diene;methyl formate |
|---|---|
| PubChem CID | 160882104 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 5-diazocyclohexa-1,3-diene;methyl formate |
| SMILES | COC=O.[N-]=[N+]=C1C=CC=CC1 |
| InChI | InChI=1S/C6H6N2.C2H4O2/c7-8-6-4-2-1-3-5-6;1-4-2-3/h1-4H,5H2;2H,1H3 |
| InChIKey | SNDZOCIGVGIRPO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|