C7H9ClN2 — CID 141328980
5-diazo-1-methylcyclohexa-1,3-diene;hydrochloride (PubChem CID 141328980) has the molecular formula C7H9ClN2 and a molecular weight of 156.62 g/mol. Its IUPAC name is 5-diazo-1-methylcyclohexa-1,3-diene;hydrochloride.
| Compound Name | 5-diazo-1-methylcyclohexa-1,3-diene;hydrochloride |
|---|---|
| PubChem CID | 141328980 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 5-diazo-1-methylcyclohexa-1,3-diene;hydrochloride |
| SMILES | CC1=CC=CC(=[N+]=[N-])C1.Cl |
| InChI | InChI=1S/C7H8N2.ClH/c1-6-3-2-4-7(5-6)9-8;/h2-4H,5H2,1H3;1H |
| InChIKey | ASGOXSYQMAKORH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|