C8H11NO — CID 173259374
N-methoxy-5-methylcyclohexa-2,4-dien-1-imine (PubChem CID 173259374) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is N-methoxy-5-methylcyclohexa-2,4-dien-1-imine.
| Compound Name | N-methoxy-5-methylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 173259374 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | N-methoxy-5-methylcyclohexa-2,4-dien-1-imine |
| SMILES | CON=C1C=CC=C(C)C1 |
| InChI | InChI=1S/C8H11NO/c1-7-4-3-5-8(6-7)9-10-2/h3-5H,6H2,1-2H3 |
| InChIKey | BUEZHSBAULOIJA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|