About (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene
(5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene (PubChem CID 142094976) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene.
Analyze (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene?
The IUPAC name of (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene (CID 142094976) is (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene.
What is the SMILES notation for (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene?
The canonical SMILES for (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene is C=C/C=C1/C=CC=C(C)C1.
What is the InChIKey of (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene?
The InChIKey is FEWZRFXRRMOETN-YHYXMXQVSA-N. The full InChI is InChI=1S/C10H12/c1-3-5-10-7-4-6-9(2)8-10/h3-7H,1,8H2,2H3/b10-5-.
What are the key properties of (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene?
(5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene has a molecular weight of 132.21 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-1-methyl-5-prop-2-enylidenecyclohexa-1,3-diene is sourced from PubChem (CID 142094976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).