C7H8N2O4S — CID 54387264
(3-diazocyclohexa-1,5-dien-1-yl)-hydroxymethanesulfonic acid (PubChem CID 54387264) has the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. Its IUPAC name is (3-diazocyclohexa-1,5-dien-1-yl)-hydroxymethanesulfonic acid.
| Compound Name | (3-diazocyclohexa-1,5-dien-1-yl)-hydroxymethanesulfonic acid |
|---|---|
| PubChem CID | 54387264 |
| Molecular Formula | C7H8N2O4S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | (3-diazocyclohexa-1,5-dien-1-yl)-hydroxymethanesulfonic acid |
| SMILES | [N-]=[N+]=C1C=C(C(O)S(=O)(=O)O)C=CC1 |
| InChI | InChI=1S/C7H8N2O4S/c8-9-6-3-1-2-5(4-6)7(10)14(11,12)13/h1-2,4,7,10H,3H2,(H,11,12,13) |
| InChIKey | VECMTSTZZKQBGG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|