C12H10N2O3S2 — CID 54326371
3-diazo-6-phenylsulfanylcyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 54326371) has the molecular formula C12H10N2O3S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-diazo-6-phenylsulfanylcyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 3-diazo-6-phenylsulfanylcyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 54326371 |
| Molecular Formula | C12H10N2O3S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3-diazo-6-phenylsulfanylcyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | [N-]=[N+]=C1C=C(S(=O)(=O)O)C(Sc2ccccc2)=CC1 |
| InChI | InChI=1S/C12H10N2O3S2/c13-14-9-6-7-11(12(8-9)19(15,16)17)18-10-4-2-1-3-5-10/h1-5,7-8H,6H2,(H,15,16,17) |
| InChIKey | SVFMSBGBWCYXNH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|