C12H10ClN2S2- — CID 86588164
5-diazo-2-(phenyldisulfanyl)cyclohexa-1,3-diene chloride (PubChem CID 86588164) has the molecular formula C12H10ClN2S2- and a molecular weight of 281.81 g/mol. Its IUPAC name is 5-diazo-2-(phenyldisulfanyl)cyclohexa-1,3-diene chloride.
| Compound Name | 5-diazo-2-(phenyldisulfanyl)cyclohexa-1,3-diene chloride |
|---|---|
| PubChem CID | 86588164 |
| Molecular Formula | C12H10ClN2S2- |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 5-diazo-2-(phenyldisulfanyl)cyclohexa-1,3-diene chloride |
| SMILES | [Cl-].[N-]=[N+]=C1C=CC(SSc2ccccc2)=CC1 |
| InChI | InChI=1S/C12H10N2S2.ClH/c13-14-10-6-8-12(9-7-10)16-15-11-4-2-1-3-5-11;/h1-6,8-9H,7H2;1H/p-1 |
| InChIKey | CNDRYZMGSVVXNY-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|