About calcium sulfenatobenzene
calcium sulfenatobenzene (PubChem CID 172805620) has the molecular formula C12H10CaO2S2
and a molecular weight of 290.42 g/mol. Its IUPAC name is calcium sulfenatobenzene.
Molecular Properties
| Compound Name | calcium sulfenatobenzene |
| PubChem CID | 172805620 |
| Molecular Formula | C12H10CaO2S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | calcium sulfenatobenzene |
| SMILES | [Ca+2].[O-]Sc1ccccc1.[O-]Sc1ccccc1 |
| InChI | InChI=1S/2C6H6OS.Ca/c2*7-8-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+2/p-2 |
| InChIKey | RLTWKVCMJJEVHC-UHFFFAOYSA-L |
| XLogP | 3.44 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium sulfenatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium sulfenatobenzene?
The IUPAC name of calcium sulfenatobenzene (CID 172805620) is calcium sulfenatobenzene.
What is the SMILES notation for calcium sulfenatobenzene?
The canonical SMILES for calcium sulfenatobenzene is [Ca+2].[O-]Sc1ccccc1.[O-]Sc1ccccc1.
What is the InChIKey of calcium sulfenatobenzene?
The InChIKey is RLTWKVCMJJEVHC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H6OS.Ca/c2*7-8-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+2/p-2.
What are the key properties of calcium sulfenatobenzene?
calcium sulfenatobenzene has a molecular weight of 290.42 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium sulfenatobenzene is sourced from PubChem (CID 172805620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).