About phenylsulfanylbenzene;urea
phenylsulfanylbenzene;urea (PubChem CID 161199097) has the molecular formula C13H14N2OS
and a molecular weight of 246.34 g/mol. Its IUPAC name is phenylsulfanylbenzene;urea.
Molecular Properties
| Compound Name | phenylsulfanylbenzene;urea |
| PubChem CID | 161199097 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | phenylsulfanylbenzene;urea |
| SMILES | NC(N)=O.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.CH4N2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h1-10H;(H4,2,3,4) |
| InChIKey | UUSWSIJWALJYGI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenylsulfanylbenzene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfanylbenzene;urea?
The IUPAC name of phenylsulfanylbenzene;urea (CID 161199097) is phenylsulfanylbenzene;urea.
What is the SMILES notation for phenylsulfanylbenzene;urea?
The canonical SMILES for phenylsulfanylbenzene;urea is NC(N)=O.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of phenylsulfanylbenzene;urea?
The InChIKey is UUSWSIJWALJYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.CH4N2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h1-10H;(H4,2,3,4).
What are the key properties of phenylsulfanylbenzene;urea?
phenylsulfanylbenzene;urea has a molecular weight of 246.34 g/mol, XLogP of 2.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfanylbenzene;urea is sourced from PubChem (CID 161199097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).