C12H9BF4N2O3 — CID 159009052
5-diazocyclohexa-1,3-diene;(2,3,4,6-tetrafluorophenoxy)boronic acid (PubChem CID 159009052) has the molecular formula C12H9BF4N2O3 and a molecular weight of 316.02 g/mol. Its IUPAC name is 5-diazocyclohexa-1,3-diene;(2,3,4,6-tetrafluorophenoxy)boronic acid.
| Compound Name | 5-diazocyclohexa-1,3-diene;(2,3,4,6-tetrafluorophenoxy)boronic acid |
|---|---|
| PubChem CID | 159009052 |
| Molecular Formula | C12H9BF4N2O3 |
| Molecular Weight | 316.02 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 5-diazocyclohexa-1,3-diene;(2,3,4,6-tetrafluorophenoxy)boronic acid |
| SMILES | OB(O)Oc1c(F)cc(F)c(F)c1F.[N-]=[N+]=C1C=CC=CC1 |
| InChI | InChI=1S/C6H3BF4O3.C6H6N2/c8-2-1-3(9)6(14-7(12)13)5(11)4(2)10;7-8-6-4-2-1-3-5-6/h1,12-13H;1-4H,5H2 |
| InChIKey | JSGZNMPLDRISNA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.02 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|