C11H3BF9NO3 — CID 175024344
(2,3,4,5,6-pentafluorophenoxy)boronic acid;2,3,5,6-tetrafluoropyridine (PubChem CID 175024344) has the molecular formula C11H3BF9NO3 and a molecular weight of 378.94 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)boronic acid;2,3,5,6-tetrafluoropyridine.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)boronic acid;2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 175024344 |
| Molecular Formula | C11H3BF9NO3 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)boronic acid;2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1cc(F)c(F)nc1F.OB(O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6H2BF5O3.C5HF4N/c8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10;6-2-1-3(7)5(9)10-4(2)8/h13-14H;1H |
| InChIKey | ADQBLBZSUZWKIG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|