C60H68BF5I2O3 — CID 172788517
(2,3,4,5,6-pentafluorophenoxy)boronic acid;bis(tris(2-phenylpropan-2-yl)-λ3-iodane) (PubChem CID 172788517) has the molecular formula C60H68BF5I2O3 and a molecular weight of 1196.81 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)boronic acid;bis(tris(2-phenylpropan-2-yl)-λ3-iodane).
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)boronic acid;bis(tris(2-phenylpropan-2-yl)-λ3-iodane) |
|---|---|
| PubChem CID | 172788517 |
| Molecular Formula | C60H68BF5I2O3 |
| Molecular Weight | 1196.81 g/mol |
| Exact Mass | 1196.33 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)boronic acid;bis(tris(2-phenylpropan-2-yl)-λ3-iodane) |
| SMILES | CC(C)(c1ccccc1)I(C(C)(C)c1ccccc1)C(C)(C)c1ccccc1.CC(C)(c1ccccc1)I(C(C)(C)c1ccccc1)C(C)(C)c1ccccc1.OB(O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/2C27H33I.C6H2BF5O3/c2*1-25(2,22-16-10-7-11-17-22)28(26(3,4)23-18-12-8-13-19-23)27(5,6)24-20-14-9-15-21-24;8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h2*7-21H,1-6H3;13-14H |
| InChIKey | PFWLYONIBDBDPZ-UHFFFAOYSA-N |
| XLogP | 17.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1196.81 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|