C24H14BCl2F5N2O3 — CID 172821560
bis(8-chloroquinoline);(2,3,4,5,6-pentafluorophenoxy)boronic acid (PubChem CID 172821560) has the molecular formula C24H14BCl2F5N2O3 and a molecular weight of 555.10 g/mol. Its IUPAC name is bis(8-chloroquinoline);(2,3,4,5,6-pentafluorophenoxy)boronic acid.
| Compound Name | bis(8-chloroquinoline);(2,3,4,5,6-pentafluorophenoxy)boronic acid |
|---|---|
| PubChem CID | 172821560 |
| Molecular Formula | C24H14BCl2F5N2O3 |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | bis(8-chloroquinoline);(2,3,4,5,6-pentafluorophenoxy)boronic acid |
| SMILES | Clc1cccc2cccnc12.Clc1cccc2cccnc12.OB(O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/2C9H6ClN.C6H2BF5O3/c2*10-8-5-1-3-7-4-2-6-11-9(7)8;8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h2*1-6H;13-14H |
| InChIKey | UHJYHQKCFUJPOT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|