About 8-chloroquinoline;1H-pyrazol-5-amine
8-chloroquinoline;1H-pyrazol-5-amine (PubChem CID 175233770) has the molecular formula C12H11ClN4
and a molecular weight of 246.70 g/mol. Its IUPAC name is 8-chloroquinoline;1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 8-chloroquinoline;1H-pyrazol-5-amine |
| PubChem CID | 175233770 |
| Molecular Formula | C12H11ClN4 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 8-chloroquinoline;1H-pyrazol-5-amine |
| SMILES | Clc1cccc2cccnc12.Nc1ccn[nH]1 |
| InChI | InChI=1S/C9H6ClN.C3H5N3/c10-8-5-1-3-7-4-2-6-11-9(7)8;4-3-1-2-5-6-3/h1-6H;1-2H,(H3,4,5,6) |
| InChIKey | IRWVUUCSAUGMIH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloroquinoline;1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloroquinoline;1H-pyrazol-5-amine?
The IUPAC name of 8-chloroquinoline;1H-pyrazol-5-amine (CID 175233770) is 8-chloroquinoline;1H-pyrazol-5-amine.
What is the SMILES notation for 8-chloroquinoline;1H-pyrazol-5-amine?
The canonical SMILES for 8-chloroquinoline;1H-pyrazol-5-amine is Clc1cccc2cccnc12.Nc1ccn[nH]1.
What is the InChIKey of 8-chloroquinoline;1H-pyrazol-5-amine?
The InChIKey is IRWVUUCSAUGMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN.C3H5N3/c10-8-5-1-3-7-4-2-6-11-9(7)8;4-3-1-2-5-6-3/h1-6H;1-2H,(H3,4,5,6).
What are the key properties of 8-chloroquinoline;1H-pyrazol-5-amine?
8-chloroquinoline;1H-pyrazol-5-amine has a molecular weight of 246.70 g/mol, XLogP of 2.88, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloroquinoline;1H-pyrazol-5-amine is sourced from PubChem (CID 175233770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).