C30H57BF4N2O3 — CID 172806877
bis(N,N-dibutylbutan-1-amine);(2,3,4,6-tetrafluorophenoxy)boronic acid (PubChem CID 172806877) has the molecular formula C30H57BF4N2O3 and a molecular weight of 580.60 g/mol. Its IUPAC name is bis(N,N-dibutylbutan-1-amine);(2,3,4,6-tetrafluorophenoxy)boronic acid.
| Compound Name | bis(N,N-dibutylbutan-1-amine);(2,3,4,6-tetrafluorophenoxy)boronic acid |
|---|---|
| PubChem CID | 172806877 |
| Molecular Formula | C30H57BF4N2O3 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.44 |
| IUPAC Name | bis(N,N-dibutylbutan-1-amine);(2,3,4,6-tetrafluorophenoxy)boronic acid |
| SMILES | CCCCN(CCCC)CCCC.CCCCN(CCCC)CCCC.OB(O)Oc1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/2C12H27N.C6H3BF4O3/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;8-2-1-3(9)6(14-7(12)13)5(11)4(2)10/h2*4-12H2,1-3H3;1,12-13H |
| InChIKey | RQBCSJSTHCGMQU-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|