C17H27BF4O3Si — CID 175297494
(2,3,4,6-tetrafluorophenoxy)boronic acid;1,1,2-triethylsilinane (PubChem CID 175297494) has the molecular formula C17H27BF4O3Si and a molecular weight of 394.29 g/mol. Its IUPAC name is (2,3,4,6-tetrafluorophenoxy)boronic acid;1,1,2-triethylsilinane.
| Compound Name | (2,3,4,6-tetrafluorophenoxy)boronic acid;1,1,2-triethylsilinane |
|---|---|
| PubChem CID | 175297494 |
| Molecular Formula | C17H27BF4O3Si |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (2,3,4,6-tetrafluorophenoxy)boronic acid;1,1,2-triethylsilinane |
| SMILES | CCC1CCCC[Si]1(CC)CC.OB(O)Oc1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C11H24Si.C6H3BF4O3/c1-4-11-9-7-8-10-12(11,5-2)6-3;8-2-1-3(9)6(14-7(12)13)5(11)4(2)10/h11H,4-10H2,1-3H3;1,12-13H |
| InChIKey | WLVRLNRUWQQUMQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|