C50H55O5+ — CID 135819073
2,6-bis(4-pentoxyphenyl)-4-[(Z)-[2-(4-pentoxyphenyl)-6-phenylpyran-4-ylidene]methyl]pyrylium (PubChem CID 135819073) has the molecular formula C50H55O5+ and a molecular weight of 735.99 g/mol. Its IUPAC name is 2,6-bis(4-pentoxyphenyl)-4-[(Z)-[2-(4-pentoxyphenyl)-6-phenylpyran-4-ylidene]methyl]pyrylium.
| Compound Name | 2,6-bis(4-pentoxyphenyl)-4-[(Z)-[2-(4-pentoxyphenyl)-6-phenylpyran-4-ylidene]methyl]pyrylium |
|---|---|
| PubChem CID | 135819073 |
| Molecular Formula | C50H55O5+ |
| Molecular Weight | 735.99 g/mol |
| Exact Mass | 735.40 |
| IUPAC Name | 2,6-bis(4-pentoxyphenyl)-4-[(Z)-[2-(4-pentoxyphenyl)-6-phenylpyran-4-ylidene]methyl]pyrylium |
| SMILES | CCCCCOc1ccc(C2=C/C(=C\c3cc(-c4ccc(OCCCCC)cc4)[o+]c(-c4ccc(OCCCCC)cc4)c3)C=C(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C50H55O5/c1-4-7-13-30-51-44-24-18-41(19-25-44)48-35-38(34-47(54-48)40-16-11-10-12-17-40)33-39-36-49(42-20-26-45(27-21-42)52-31-14-8-5-2)55-50(37-39)43-22-28-46(29-23-43)53-32-15-9-6-3/h10-12,16-29,33-37H,4-9,13-15,30-32H2,1-3H3/q+1 |
| InChIKey | URPUNCSTSSGMNG-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.99 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|