C38H55O3+ — CID 4582686
2,4-bis(4-decoxyphenyl)-6-methylpyrylium (PubChem CID 4582686) has the molecular formula C38H55O3+ and a molecular weight of 559.86 g/mol. Its IUPAC name is 2,4-bis(4-decoxyphenyl)-6-methylpyrylium.
| Compound Name | 2,4-bis(4-decoxyphenyl)-6-methylpyrylium |
|---|---|
| PubChem CID | 4582686 |
| Molecular Formula | C38H55O3+ |
| Molecular Weight | 559.86 g/mol |
| Exact Mass | 559.41 |
| IUPAC Name | 2,4-bis(4-decoxyphenyl)-6-methylpyrylium |
| SMILES | CCCCCCCCCCOc1ccc(-c2cc(C)[o+]c(-c3ccc(OCCCCCCCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C38H55O3/c1-4-6-8-10-12-14-16-18-28-39-36-24-20-33(21-25-36)35-30-32(3)41-38(31-35)34-22-26-37(27-23-34)40-29-19-17-15-13-11-9-7-5-2/h20-27,30-31H,4-19,28-29H2,1-3H3/q+1 |
| InChIKey | HDNYIDDQTAEWBM-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.86 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|